C17H26Br2O2 — CID 63440778
1-bromo-2-(1-bromo-3,5,5-trimethylhexyl)-4,5-dimethoxybenzene (PubChem CID 63440778) has the molecular formula C17H26Br2O2 and a molecular weight of 422.20 g/mol. Its IUPAC name is 1-bromo-2-(1-bromo-3,5,5-trimethylhexyl)-4,5-dimethoxybenzene.
| Compound Name | 1-bromo-2-(1-bromo-3,5,5-trimethylhexyl)-4,5-dimethoxybenzene |
|---|---|
| PubChem CID | 63440778 |
| Molecular Formula | C17H26Br2O2 |
| Molecular Weight | 422.20 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 1-bromo-2-(1-bromo-3,5,5-trimethylhexyl)-4,5-dimethoxybenzene |
| SMILES | COc1cc(Br)c(C(Br)CC(C)CC(C)(C)C)cc1OC |
| InChI | InChI=1S/C17H26Br2O2/c1-11(10-17(2,3)4)7-13(18)12-8-15(20-5)16(21-6)9-14(12)19/h8-9,11,13H,7,10H2,1-6H3 |
| InChIKey | LIERBNBFUIVAKG-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.20 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|