C16H24Br2O — CID 55197779
2-bromo-4-(1-bromo-3,5,5-trimethylhexyl)-1-methoxybenzene (PubChem CID 55197779) has the molecular formula C16H24Br2O and a molecular weight of 392.18 g/mol. Its IUPAC name is 2-bromo-4-(1-bromo-3,5,5-trimethylhexyl)-1-methoxybenzene.
| Compound Name | 2-bromo-4-(1-bromo-3,5,5-trimethylhexyl)-1-methoxybenzene |
|---|---|
| PubChem CID | 55197779 |
| Molecular Formula | C16H24Br2O |
| Molecular Weight | 392.18 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 2-bromo-4-(1-bromo-3,5,5-trimethylhexyl)-1-methoxybenzene |
| SMILES | COc1ccc(C(Br)CC(C)CC(C)(C)C)cc1Br |
| InChI | InChI=1S/C16H24Br2O/c1-11(10-16(2,3)4)8-13(17)12-6-7-15(19-5)14(18)9-12/h6-7,9,11,13H,8,10H2,1-5H3 |
| InChIKey | NJVVAKBKWBCCSB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.18 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|