C18H29Br — CID 63443331
1-(1-bromo-3,5,5-trimethylhexyl)-4-propan-2-ylbenzene (PubChem CID 63443331) has the molecular formula C18H29Br and a molecular weight of 325.33 g/mol. Its IUPAC name is 1-(1-bromo-3,5,5-trimethylhexyl)-4-propan-2-ylbenzene.
| Compound Name | 1-(1-bromo-3,5,5-trimethylhexyl)-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 63443331 |
| Molecular Formula | C18H29Br |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-(1-bromo-3,5,5-trimethylhexyl)-4-propan-2-ylbenzene |
| SMILES | CC(CC(Br)c1ccc(C(C)C)cc1)CC(C)(C)C |
| InChI | InChI=1S/C18H29Br/c1-13(2)15-7-9-16(10-8-15)17(19)11-14(3)12-18(4,5)6/h7-10,13-14,17H,11-12H2,1-6H3 |
| InChIKey | VAZFIAIUUUSDLX-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|