C15H25N — CID 157318275
2-(4,4-dimethylpentan-2-yl)-5-propan-2-ylpyridine (PubChem CID 157318275) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 2-(4,4-dimethylpentan-2-yl)-5-propan-2-ylpyridine.
| Compound Name | 2-(4,4-dimethylpentan-2-yl)-5-propan-2-ylpyridine |
|---|---|
| PubChem CID | 157318275 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 2-(4,4-dimethylpentan-2-yl)-5-propan-2-ylpyridine |
| SMILES | CC(C)c1ccc(C(C)CC(C)(C)C)nc1 |
| InChI | InChI=1S/C15H25N/c1-11(2)13-7-8-14(16-10-13)12(3)9-15(4,5)6/h7-8,10-12H,9H2,1-6H3 |
| InChIKey | FXKZCAHRNUCSAF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |