C10H15NO2 — CID 121261456
1-(6-propan-2-yl-3-pyridinyl)ethane-1,2-diol (PubChem CID 121261456) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 1-(6-propan-2-yl-3-pyridinyl)ethane-1,2-diol.
| Compound Name | 1-(6-propan-2-yl-3-pyridinyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 121261456 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 1-(6-propan-2-yl-3-pyridinyl)ethane-1,2-diol |
| SMILES | CC(C)c1ccc(C(O)CO)cn1 |
| InChI | InChI=1S/C10H15NO2/c1-7(2)9-4-3-8(5-11-9)10(13)6-12/h3-5,7,10,12-13H,6H2,1-2H3 |
| InChIKey | WZFFPBXRTVYWBY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |