C10H14O3 — CID 117279181
1-[4-(1-hydroxyethyl)phenyl]ethane-1,2-diol (PubChem CID 117279181) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-[4-(1-hydroxyethyl)phenyl]ethane-1,2-diol.
| Compound Name | 1-[4-(1-hydroxyethyl)phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 117279181 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-[4-(1-hydroxyethyl)phenyl]ethane-1,2-diol |
| SMILES | CC(O)c1ccc(C(O)CO)cc1 |
| InChI | InChI=1S/C10H14O3/c1-7(12)8-2-4-9(5-3-8)10(13)6-11/h2-5,7,10-13H,6H2,1H3 |
| InChIKey | WFAIPYXKWSQZGY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |