C9H11ClO2 — CID 88977117
1-[4-(chloromethyl)phenyl]ethane-1,2-diol (PubChem CID 88977117) has the molecular formula C9H11ClO2 and a molecular weight of 186.64 g/mol. Its IUPAC name is 1-[4-(chloromethyl)phenyl]ethane-1,2-diol.
| Compound Name | 1-[4-(chloromethyl)phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 88977117 |
| Molecular Formula | C9H11ClO2 |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 1-[4-(chloromethyl)phenyl]ethane-1,2-diol |
| SMILES | OCC(O)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C9H11ClO2/c10-5-7-1-3-8(4-2-7)9(12)6-11/h1-4,9,11-12H,5-6H2 |
| InChIKey | JFTGDCGAUVOFPT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|