C8H12N2O2 — CID 91166316
1-(3,4-diaminophenyl)ethane-1,2-diol (PubChem CID 91166316) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-(3,4-diaminophenyl)ethane-1,2-diol.
| Compound Name | 1-(3,4-diaminophenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 91166316 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 1-(3,4-diaminophenyl)ethane-1,2-diol |
| SMILES | Nc1ccc(C(O)CO)cc1N |
| InChI | InChI=1S/C8H12N2O2/c9-6-2-1-5(3-7(6)10)8(12)4-11/h1-3,8,11-12H,4,9-10H2 |
| InChIKey | HRECPCZJDULSRL-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|