C10H15NO4 — CID 170817978
1-(3-amino-4-methoxyphenyl)propane-1,2,3-triol (PubChem CID 170817978) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 1-(3-amino-4-methoxyphenyl)propane-1,2,3-triol.
| Compound Name | 1-(3-amino-4-methoxyphenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817978 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-(3-amino-4-methoxyphenyl)propane-1,2,3-triol |
| SMILES | COc1ccc(C(O)C(O)CO)cc1N |
| InChI | InChI=1S/C10H15NO4/c1-15-9-3-2-6(4-7(9)11)10(14)8(13)5-12/h2-4,8,10,12-14H,5,11H2,1H3 |
| InChIKey | WGJGCMOJUJLEIH-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|