C10H16N2O2 — CID 55269885
(1S,2S)-1-amino-1-(3-amino-4-methoxyphenyl)propan-2-ol (PubChem CID 55269885) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is (1S,2S)-1-amino-1-(3-amino-4-methoxyphenyl)propan-2-ol.
| Compound Name | (1S,2S)-1-amino-1-(3-amino-4-methoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 55269885 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (1S,2S)-1-amino-1-(3-amino-4-methoxyphenyl)propan-2-ol |
| SMILES | COc1ccc([C@H](N)[C@H](C)O)cc1N |
| InChI | InChI=1S/C10H16N2O2/c1-6(13)10(12)7-3-4-9(14-2)8(11)5-7/h3-6,10,13H,11-12H2,1-2H3/t6-,10+/m0/s1 |
| InChIKey | KJOLYNOLMBLLRE-QUBYGPBYSA-N |
| XLogP | 0.66 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|