C11H16O2 — CID 155397805
1-(3-propan-2-ylphenyl)ethane-1,2-diol (PubChem CID 155397805) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-(3-propan-2-ylphenyl)ethane-1,2-diol.
| Compound Name | 1-(3-propan-2-ylphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 155397805 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 1-(3-propan-2-ylphenyl)ethane-1,2-diol |
| SMILES | CC(C)c1cccc(C(O)CO)c1 |
| InChI | InChI=1S/C11H16O2/c1-8(2)9-4-3-5-10(6-9)11(13)7-12/h3-6,8,11-13H,7H2,1-2H3 |
| InChIKey | WYWMKZIVNACQKH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |