C17H22O4 — CID 159196107
1-phenylethane-1,2-diol;1-phenylpropane-1,2-diol (PubChem CID 159196107) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1-phenylethane-1,2-diol;1-phenylpropane-1,2-diol.
| Compound Name | 1-phenylethane-1,2-diol;1-phenylpropane-1,2-diol |
|---|---|
| PubChem CID | 159196107 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-phenylethane-1,2-diol;1-phenylpropane-1,2-diol |
| SMILES | CC(O)C(O)c1ccccc1.OCC(O)c1ccccc1 |
| InChI | InChI=1S/C9H12O2.C8H10O2/c1-7(10)9(11)8-5-3-2-4-6-8;9-6-8(10)7-4-2-1-3-5-7/h2-7,9-11H,1H3;1-5,8-10H,6H2 |
| InChIKey | KORJIHIXRMHJBH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |