C10H14O3 — CID 14940547
(2R,4R)-4-phenylbutane-1,2,4-triol (PubChem CID 14940547) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (2R,4R)-4-phenylbutane-1,2,4-triol.
| Compound Name | (2R,4R)-4-phenylbutane-1,2,4-triol |
|---|---|
| PubChem CID | 14940547 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (2R,4R)-4-phenylbutane-1,2,4-triol |
| SMILES | OC[C@H](O)C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C10H14O3/c11-7-9(12)6-10(13)8-4-2-1-3-5-8/h1-5,9-13H,6-7H2/t9-,10-/m1/s1 |
| InChIKey | DHURKUJTEAIZJM-NXEZZACHSA-N |
| XLogP | 0.46 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |