C11H16O3 — CID 11687059
(1R)-3,3-dimethoxy-1-phenylpropan-1-ol (PubChem CID 11687059) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (1R)-3,3-dimethoxy-1-phenylpropan-1-ol.
| Compound Name | (1R)-3,3-dimethoxy-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 11687059 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (1R)-3,3-dimethoxy-1-phenylpropan-1-ol |
| SMILES | COC(C[C@@H](O)c1ccccc1)OC |
| InChI | InChI=1S/C11H16O3/c1-13-11(14-2)8-10(12)9-6-4-3-5-7-9/h3-7,10-12H,8H2,1-2H3/t10-/m1/s1 |
| InChIKey | CVLDBSJNMSOCLT-SNVBAGLBSA-N |
| XLogP | 1.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|