About 2-amino-1-phenylethanol;ethane
2-amino-1-phenylethanol;ethane (PubChem CID 91425169) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-amino-1-phenylethanol;ethane.
Molecular Properties
| Compound Name | 2-amino-1-phenylethanol;ethane |
| PubChem CID | 91425169 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-amino-1-phenylethanol;ethane |
| SMILES | CC.NCC(O)c1ccccc1 |
| InChI | InChI=1S/C8H11NO.C2H6/c9-6-8(10)7-4-2-1-3-5-7;1-2/h1-5,8,10H,6,9H2;1-2H3 |
| InChIKey | TZVDPDDBUMNCQV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-1-phenylethanol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-phenylethanol;ethane?
The IUPAC name of 2-amino-1-phenylethanol;ethane (CID 91425169) is 2-amino-1-phenylethanol;ethane.
What is the SMILES notation for 2-amino-1-phenylethanol;ethane?
The canonical SMILES for 2-amino-1-phenylethanol;ethane is CC.NCC(O)c1ccccc1.
What is the InChIKey of 2-amino-1-phenylethanol;ethane?
The InChIKey is TZVDPDDBUMNCQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C2H6/c9-6-8(10)7-4-2-1-3-5-7;1-2/h1-5,8,10H,6,9H2;1-2H3.
What are the key properties of 2-amino-1-phenylethanol;ethane?
2-amino-1-phenylethanol;ethane has a molecular weight of 167.25 g/mol, XLogP of 1.70, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-phenylethanol;ethane is sourced from PubChem (CID 91425169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).