About 1-phenylpropan-1-ol;hydrate
1-phenylpropan-1-ol;hydrate (PubChem CID 156782934) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 1-phenylpropan-1-ol;hydrate.
Molecular Properties
| Compound Name | 1-phenylpropan-1-ol;hydrate |
| PubChem CID | 156782934 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 1-phenylpropan-1-ol;hydrate |
| SMILES | CCC(O)c1ccccc1.O |
| InChI | InChI=1S/C9H12O.H2O/c1-2-9(10)8-6-4-3-5-7-8;/h3-7,9-10H,2H2,1H3;1H2 |
| InChIKey | AZSGPIBGVZUILS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenylpropan-1-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropan-1-ol;hydrate?
The IUPAC name of 1-phenylpropan-1-ol;hydrate (CID 156782934) is 1-phenylpropan-1-ol;hydrate.
What is the SMILES notation for 1-phenylpropan-1-ol;hydrate?
The canonical SMILES for 1-phenylpropan-1-ol;hydrate is CCC(O)c1ccccc1.O.
What is the InChIKey of 1-phenylpropan-1-ol;hydrate?
The InChIKey is AZSGPIBGVZUILS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.H2O/c1-2-9(10)8-6-4-3-5-7-8;/h3-7,9-10H,2H2,1H3;1H2.
What are the key properties of 1-phenylpropan-1-ol;hydrate?
1-phenylpropan-1-ol;hydrate has a molecular weight of 154.21 g/mol, XLogP of 1.31, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropan-1-ol;hydrate is sourced from PubChem (CID 156782934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).