About 1-phenylpropan-1-ol;3-phenylprop-2-enoic acid
1-phenylpropan-1-ol;3-phenylprop-2-enoic acid (PubChem CID 174889683) has the molecular formula C18H20O3
and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-phenylpropan-1-ol;3-phenylprop-2-enoic acid.
Molecular Properties
| Compound Name | 1-phenylpropan-1-ol;3-phenylprop-2-enoic acid |
| PubChem CID | 174889683 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-phenylpropan-1-ol;3-phenylprop-2-enoic acid |
| SMILES | CCC(O)c1ccccc1.O=C(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C9H8O2.C9H12O/c10-9(11)7-6-8-4-2-1-3-5-8;1-2-9(10)8-6-4-3-5-7-8/h1-7H,(H,10,11);3-7,9-10H,2H2,1H3 |
| InChIKey | NCOJEYNMUNXOHR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylpropan-1-ol;3-phenylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropan-1-ol;3-phenylprop-2-enoic acid?
The IUPAC name of 1-phenylpropan-1-ol;3-phenylprop-2-enoic acid (CID 174889683) is 1-phenylpropan-1-ol;3-phenylprop-2-enoic acid.
What is the SMILES notation for 1-phenylpropan-1-ol;3-phenylprop-2-enoic acid?
The canonical SMILES for 1-phenylpropan-1-ol;3-phenylprop-2-enoic acid is CCC(O)c1ccccc1.O=C(O)C=Cc1ccccc1.
What is the InChIKey of 1-phenylpropan-1-ol;3-phenylprop-2-enoic acid?
The InChIKey is NCOJEYNMUNXOHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2.C9H12O/c10-9(11)7-6-8-4-2-1-3-5-8;1-2-9(10)8-6-4-3-5-7-8/h1-7H,(H,10,11);3-7,9-10H,2H2,1H3.
What are the key properties of 1-phenylpropan-1-ol;3-phenylprop-2-enoic acid?
1-phenylpropan-1-ol;3-phenylprop-2-enoic acid has a molecular weight of 284.36 g/mol, XLogP of 3.91, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropan-1-ol;3-phenylprop-2-enoic acid is sourced from PubChem (CID 174889683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).