About pentanoic acid;3-phenylprop-2-enoic acid
pentanoic acid;3-phenylprop-2-enoic acid (PubChem CID 130331806) has the molecular formula C14H18O4
and a molecular weight of 250.29 g/mol. Its IUPAC name is pentanoic acid;3-phenylprop-2-enoic acid.
Molecular Properties
| Compound Name | pentanoic acid;3-phenylprop-2-enoic acid |
| PubChem CID | 130331806 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | pentanoic acid;3-phenylprop-2-enoic acid |
| SMILES | CCCCC(=O)O.O=C(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C9H8O2.C5H10O2/c10-9(11)7-6-8-4-2-1-3-5-8;1-2-3-4-5(6)7/h1-7H,(H,10,11);2-4H2,1H3,(H,6,7) |
| InChIKey | SVTOPGKBSOBNMA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze pentanoic acid;3-phenylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanoic acid;3-phenylprop-2-enoic acid?
The IUPAC name of pentanoic acid;3-phenylprop-2-enoic acid (CID 130331806) is pentanoic acid;3-phenylprop-2-enoic acid.
What is the SMILES notation for pentanoic acid;3-phenylprop-2-enoic acid?
The canonical SMILES for pentanoic acid;3-phenylprop-2-enoic acid is CCCCC(=O)O.O=C(O)C=Cc1ccccc1.
What is the InChIKey of pentanoic acid;3-phenylprop-2-enoic acid?
The InChIKey is SVTOPGKBSOBNMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2.C5H10O2/c10-9(11)7-6-8-4-2-1-3-5-8;1-2-3-4-5(6)7/h1-7H,(H,10,11);2-4H2,1H3,(H,6,7).
What are the key properties of pentanoic acid;3-phenylprop-2-enoic acid?
pentanoic acid;3-phenylprop-2-enoic acid has a molecular weight of 250.29 g/mol, XLogP of 3.05, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentanoic acid;3-phenylprop-2-enoic acid is sourced from PubChem (CID 130331806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).