About 1-phenylpropan-1-ol;2-phenylpropan-2-ol
1-phenylpropan-1-ol;2-phenylpropan-2-ol (PubChem CID 174769511) has the molecular formula C18H24O2
and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-phenylpropan-1-ol;2-phenylpropan-2-ol.
Molecular Properties
| Compound Name | 1-phenylpropan-1-ol;2-phenylpropan-2-ol |
| PubChem CID | 174769511 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1-phenylpropan-1-ol;2-phenylpropan-2-ol |
| SMILES | CC(C)(O)c1ccccc1.CCC(O)c1ccccc1 |
| InChI | InChI=1S/2C9H12O/c1-9(2,10)8-6-4-3-5-7-8;1-2-9(10)8-6-4-3-5-7-8/h3-7,10H,1-2H3;3-7,9-10H,2H2,1H3 |
| InChIKey | KPSMAYQMIDPMST-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenylpropan-1-ol;2-phenylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropan-1-ol;2-phenylpropan-2-ol?
The IUPAC name of 1-phenylpropan-1-ol;2-phenylpropan-2-ol (CID 174769511) is 1-phenylpropan-1-ol;2-phenylpropan-2-ol.
What is the SMILES notation for 1-phenylpropan-1-ol;2-phenylpropan-2-ol?
The canonical SMILES for 1-phenylpropan-1-ol;2-phenylpropan-2-ol is CC(C)(O)c1ccccc1.CCC(O)c1ccccc1.
What is the InChIKey of 1-phenylpropan-1-ol;2-phenylpropan-2-ol?
The InChIKey is KPSMAYQMIDPMST-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H12O/c1-9(2,10)8-6-4-3-5-7-8;1-2-9(10)8-6-4-3-5-7-8/h3-7,10H,1-2H3;3-7,9-10H,2H2,1H3.
What are the key properties of 1-phenylpropan-1-ol;2-phenylpropan-2-ol?
1-phenylpropan-1-ol;2-phenylpropan-2-ol has a molecular weight of 272.39 g/mol, XLogP of 4.04, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropan-1-ol;2-phenylpropan-2-ol is sourced from PubChem (CID 174769511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).