C9H12O — CID 175690859
(1S,2R)-2-deuterio-1-phenylpropan-1-ol (PubChem CID 175690859) has the molecular formula C9H12O and a molecular weight of 137.20 g/mol. Its IUPAC name is (1S,2R)-2-deuterio-1-phenylpropan-1-ol.
| Compound Name | (1S,2R)-2-deuterio-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 175690859 |
| Molecular Formula | C9H12O |
| Molecular Weight | 137.20 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | (1S,2R)-2-deuterio-1-phenylpropan-1-ol |
| SMILES | [2H][C@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C9H12O/c1-2-9(10)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3/t9-/m0/s1/i2D/t2-,9+/m1 |
| InChIKey | DYUQAZSOFZSPHD-GQNYHBPNSA-N |
| XLogP | 2.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |