C16H18O2 — CID 13113333
(1S,3R)-1,3-diphenylbutane-1,3-diol (PubChem CID 13113333) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is (1S,3R)-1,3-diphenylbutane-1,3-diol.
| Compound Name | (1S,3R)-1,3-diphenylbutane-1,3-diol |
|---|---|
| PubChem CID | 13113333 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (1S,3R)-1,3-diphenylbutane-1,3-diol |
| SMILES | C[C@@](O)(C[C@H](O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18O2/c1-16(18,14-10-6-3-7-11-14)12-15(17)13-8-4-2-5-9-13/h2-11,15,17-18H,12H2,1H3/t15-,16+/m0/s1 |
| InChIKey | QOLJHIWNNZXPMQ-JKSUJKDBSA-N |
| XLogP | 3.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |