C18H20O2 — CID 12996819
2-methylidene-1,4-diphenylpentane-1,4-diol (PubChem CID 12996819) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-methylidene-1,4-diphenylpentane-1,4-diol.
| Compound Name | 2-methylidene-1,4-diphenylpentane-1,4-diol |
|---|---|
| PubChem CID | 12996819 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-methylidene-1,4-diphenylpentane-1,4-diol |
| SMILES | C=C(CC(C)(O)c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C18H20O2/c1-14(17(19)15-9-5-3-6-10-15)13-18(2,20)16-11-7-4-8-12-16/h3-12,17,19-20H,1,13H2,2H3 |
| InChIKey | MEDREADGLXSPEL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|