C17H20O2 — CID 139037078
(2S,4R)-2,4-diphenylpentane-2,4-diol (PubChem CID 139037078) has the molecular formula C17H20O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is (2S,4R)-2,4-diphenylpentane-2,4-diol.
| Compound Name | (2S,4R)-2,4-diphenylpentane-2,4-diol |
|---|---|
| PubChem CID | 139037078 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (2S,4R)-2,4-diphenylpentane-2,4-diol |
| SMILES | C[C@](O)(C[C@@](C)(O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20O2/c1-16(18,14-9-5-3-6-10-14)13-17(2,19)15-11-7-4-8-12-15/h3-12,18-19H,13H2,1-2H3/t16-,17+ |
| InChIKey | YAOJGXOSRNJYTN-CALCHBBNSA-N |
| XLogP | 3.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |