C17H18O6 — CID 22438373
2-hydroxy-2-phenylacetic acid;2-hydroxy-2-phenylpropanoic acid (PubChem CID 22438373) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-hydroxy-2-phenylacetic acid;2-hydroxy-2-phenylpropanoic acid.
| Compound Name | 2-hydroxy-2-phenylacetic acid;2-hydroxy-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 22438373 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-hydroxy-2-phenylacetic acid;2-hydroxy-2-phenylpropanoic acid |
| SMILES | CC(O)(C(=O)O)c1ccccc1.O=C(O)C(O)c1ccccc1 |
| InChI | InChI=1S/C9H10O3.C8H8O3/c1-9(12,8(10)11)7-5-3-2-4-6-7;9-7(8(10)11)6-4-2-1-3-5-6/h2-6,12H,1H3,(H,10,11);1-5,7,9H,(H,10,11) |
| InChIKey | YOKFUOHZNXGHGC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |