About 2-methylpropan-2-ol;1-phenylethanol
2-methylpropan-2-ol;1-phenylethanol (PubChem CID 160949043) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-methylpropan-2-ol;1-phenylethanol.
Molecular Properties
| Compound Name | 2-methylpropan-2-ol;1-phenylethanol |
| PubChem CID | 160949043 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 2-methylpropan-2-ol;1-phenylethanol |
| SMILES | CC(C)(C)O.CC(O)c1ccccc1 |
| InChI | InChI=1S/C8H10O.C4H10O/c1-7(9)8-5-3-2-4-6-8;1-4(2,3)5/h2-7,9H,1H3;5H,1-3H3 |
| InChIKey | SVMXJBYZGDODOG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpropan-2-ol;1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropan-2-ol;1-phenylethanol?
The IUPAC name of 2-methylpropan-2-ol;1-phenylethanol (CID 160949043) is 2-methylpropan-2-ol;1-phenylethanol.
What is the SMILES notation for 2-methylpropan-2-ol;1-phenylethanol?
The canonical SMILES for 2-methylpropan-2-ol;1-phenylethanol is CC(C)(C)O.CC(O)c1ccccc1.
What is the InChIKey of 2-methylpropan-2-ol;1-phenylethanol?
The InChIKey is SVMXJBYZGDODOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C4H10O/c1-7(9)8-5-3-2-4-6-8;1-4(2,3)5/h2-7,9H,1H3;5H,1-3H3.
What are the key properties of 2-methylpropan-2-ol;1-phenylethanol?
2-methylpropan-2-ol;1-phenylethanol has a molecular weight of 196.29 g/mol, XLogP of 2.52, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropan-2-ol;1-phenylethanol is sourced from PubChem (CID 160949043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).