C14H24O3 — CID 67631199
2,3-dimethylbutane-2,3-diol;1-phenylethanol (PubChem CID 67631199) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 2,3-dimethylbutane-2,3-diol;1-phenylethanol.
| Compound Name | 2,3-dimethylbutane-2,3-diol;1-phenylethanol |
|---|---|
| PubChem CID | 67631199 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 2,3-dimethylbutane-2,3-diol;1-phenylethanol |
| SMILES | CC(C)(O)C(C)(C)O.CC(O)c1ccccc1 |
| InChI | InChI=1S/C8H10O.C6H14O2/c1-7(9)8-5-3-2-4-6-8;1-5(2,7)6(3,4)8/h2-7,9H,1H3;7-8H,1-4H3 |
| InChIKey | DEDPPCDEQUHOSN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |