About carbanide;(1R)-1-phenylethanol;zinc
carbanide;(1R)-1-phenylethanol;zinc (PubChem CID 177390370) has the molecular formula C9H13OZn-
and a molecular weight of 202.59 g/mol. Its IUPAC name is carbanide;(1R)-1-phenylethanol;zinc.
Molecular Properties
| Compound Name | carbanide;(1R)-1-phenylethanol;zinc |
| PubChem CID | 177390370 |
| Molecular Formula | C9H13OZn- |
| Molecular Weight | 202.59 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | carbanide;(1R)-1-phenylethanol;zinc |
| SMILES | C[C@@H](O)c1ccccc1.[CH3-].[Zn] |
| InChI | InChI=1S/C8H10O.CH3.Zn/c1-7(9)8-5-3-2-4-6-8;;/h2-7,9H,1H3;1H3;/q;-1;/t7-;;/m1../s1 |
| InChIKey | XVJWVBZKTHUDIW-XCUBXKJBSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.59 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze carbanide;(1R)-1-phenylethanol;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;(1R)-1-phenylethanol;zinc?
The IUPAC name of carbanide;(1R)-1-phenylethanol;zinc (CID 177390370) is carbanide;(1R)-1-phenylethanol;zinc.
What is the SMILES notation for carbanide;(1R)-1-phenylethanol;zinc?
The canonical SMILES for carbanide;(1R)-1-phenylethanol;zinc is C[C@@H](O)c1ccccc1.[CH3-].[Zn].
What is the InChIKey of carbanide;(1R)-1-phenylethanol;zinc?
The InChIKey is XVJWVBZKTHUDIW-XCUBXKJBSA-N. The full InChI is InChI=1S/C8H10O.CH3.Zn/c1-7(9)8-5-3-2-4-6-8;;/h2-7,9H,1H3;1H3;/q;-1;/t7-;;/m1../s1.
What are the key properties of carbanide;(1R)-1-phenylethanol;zinc?
carbanide;(1R)-1-phenylethanol;zinc has a molecular weight of 202.59 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;(1R)-1-phenylethanol;zinc is sourced from PubChem (CID 177390370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).