About (1S)-1-phenylethanol
(1S)-1-phenylethanol (PubChem CID 157125626) has the molecular formula C16H20O2
and a molecular weight of 244.33 g/mol. Its IUPAC name is (1S)-1-phenylethanol.
Molecular Properties
| Compound Name | (1S)-1-phenylethanol |
| PubChem CID | 157125626 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (1S)-1-phenylethanol |
| SMILES | C[C@H](O)c1ccccc1.C[C@H](O)c1ccccc1 |
| InChI | InChI=1S/2C8H10O/c2*1-7(9)8-5-3-2-4-6-8/h2*2-7,9H,1H3/t2*7-/m00/s1 |
| InChIKey | AILYJCHMDSZEOL-VGMFFHCQSA-N |
| XLogP | 3.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-phenylethanol?
The IUPAC name of (1S)-1-phenylethanol (CID 157125626) is (1S)-1-phenylethanol.
What is the SMILES notation for (1S)-1-phenylethanol?
The canonical SMILES for (1S)-1-phenylethanol is C[C@H](O)c1ccccc1.C[C@H](O)c1ccccc1.
What is the InChIKey of (1S)-1-phenylethanol?
The InChIKey is AILYJCHMDSZEOL-VGMFFHCQSA-N. The full InChI is InChI=1S/2C8H10O/c2*1-7(9)8-5-3-2-4-6-8/h2*2-7,9H,1H3/t2*7-/m00/s1.
What are the key properties of (1S)-1-phenylethanol?
(1S)-1-phenylethanol has a molecular weight of 244.33 g/mol, XLogP of 3.48, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-phenylethanol is sourced from PubChem (CID 157125626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).