About azane;(1R)-1-phenylethanol
azane;(1R)-1-phenylethanol (PubChem CID 126646564) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is azane;(1R)-1-phenylethanol.
Molecular Properties
| Compound Name | azane;(1R)-1-phenylethanol |
| PubChem CID | 126646564 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | azane;(1R)-1-phenylethanol |
| SMILES | C[C@@H](O)c1ccccc1.N |
| InChI | InChI=1S/C8H10O.H3N/c1-7(9)8-5-3-2-4-6-8;/h2-7,9H,1H3;1H3/t7-;/m1./s1 |
| InChIKey | JYZIFKMDXJSPIZ-OGFXRTJISA-N |
| XLogP | 1.90 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;(1R)-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(1R)-1-phenylethanol?
The IUPAC name of azane;(1R)-1-phenylethanol (CID 126646564) is azane;(1R)-1-phenylethanol.
What is the SMILES notation for azane;(1R)-1-phenylethanol?
The canonical SMILES for azane;(1R)-1-phenylethanol is C[C@@H](O)c1ccccc1.N.
What is the InChIKey of azane;(1R)-1-phenylethanol?
The InChIKey is JYZIFKMDXJSPIZ-OGFXRTJISA-N. The full InChI is InChI=1S/C8H10O.H3N/c1-7(9)8-5-3-2-4-6-8;/h2-7,9H,1H3;1H3/t7-;/m1./s1.
What are the key properties of azane;(1R)-1-phenylethanol?
azane;(1R)-1-phenylethanol has a molecular weight of 139.20 g/mol, XLogP of 1.90, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(1R)-1-phenylethanol is sourced from PubChem (CID 126646564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).