C17H20O2 — CID 100943216
(1R,3R)-2,2-dimethyl-1,3-diphenylpropane-1,3-diol (PubChem CID 100943216) has the molecular formula C17H20O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is (1R,3R)-2,2-dimethyl-1,3-diphenylpropane-1,3-diol.
| Compound Name | (1R,3R)-2,2-dimethyl-1,3-diphenylpropane-1,3-diol |
|---|---|
| PubChem CID | 100943216 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (1R,3R)-2,2-dimethyl-1,3-diphenylpropane-1,3-diol |
| SMILES | CC(C)([C@H](O)c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H20O2/c1-17(2,15(18)13-9-5-3-6-10-13)16(19)14-11-7-4-8-12-14/h3-12,15-16,18-19H,1-2H3/t15-,16-/m1/s1 |
| InChIKey | IMKKDASVJRQCLQ-HZPDHXFCSA-N |
| XLogP | 3.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |