C24H24O3 — CID 15182984
[(1R,3R)-3-hydroxy-2,2-dimethyl-1,3-diphenylpropyl] benzoate (PubChem CID 15182984) has the molecular formula C24H24O3 and a molecular weight of 360.45 g/mol. Its IUPAC name is [(1R,3R)-3-hydroxy-2,2-dimethyl-1,3-diphenylpropyl] benzoate.
| Compound Name | [(1R,3R)-3-hydroxy-2,2-dimethyl-1,3-diphenylpropyl] benzoate |
|---|---|
| PubChem CID | 15182984 |
| Molecular Formula | C24H24O3 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | [(1R,3R)-3-hydroxy-2,2-dimethyl-1,3-diphenylpropyl] benzoate |
| SMILES | CC(C)([C@H](O)c1ccccc1)[C@H](OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24O3/c1-24(2,21(25)18-12-6-3-7-13-18)22(19-14-8-4-9-15-19)27-23(26)20-16-10-5-11-17-20/h3-17,21-22,25H,1-2H3/t21-,22-/m1/s1 |
| InChIKey | PRROBJHWUBHHTK-FGZHOGPDSA-N |
| XLogP | 5.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |