About [hydroxy(phenyl)methyl] benzoate
[hydroxy(phenyl)methyl] benzoate (PubChem CID 22715526) has the molecular formula C14H12O3
and a molecular weight of 228.25 g/mol. Its IUPAC name is [hydroxy(phenyl)methyl] benzoate.
Molecular Properties
| Compound Name | [hydroxy(phenyl)methyl] benzoate |
| PubChem CID | 22715526 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | [hydroxy(phenyl)methyl] benzoate |
| SMILES | O=C(OC(O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O3/c15-13(11-7-3-1-4-8-11)17-14(16)12-9-5-2-6-10-12/h1-10,13,15H |
| InChIKey | HSRYBZDRWXSDCQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [hydroxy(phenyl)methyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [hydroxy(phenyl)methyl] benzoate?
The IUPAC name of [hydroxy(phenyl)methyl] benzoate (CID 22715526) is [hydroxy(phenyl)methyl] benzoate.
What is the SMILES notation for [hydroxy(phenyl)methyl] benzoate?
The canonical SMILES for [hydroxy(phenyl)methyl] benzoate is O=C(OC(O)c1ccccc1)c1ccccc1.
What is the InChIKey of [hydroxy(phenyl)methyl] benzoate?
The InChIKey is HSRYBZDRWXSDCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O3/c15-13(11-7-3-1-4-8-11)17-14(16)12-9-5-2-6-10-12/h1-10,13,15H.
What are the key properties of [hydroxy(phenyl)methyl] benzoate?
[hydroxy(phenyl)methyl] benzoate has a molecular weight of 228.25 g/mol, XLogP of 2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [hydroxy(phenyl)methyl] benzoate is sourced from PubChem (CID 22715526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).