C20H26O2Si — CID 122206427
2,2-dimethyl-1,3-diphenyl-3-trimethylsilyloxypropan-1-one (PubChem CID 122206427) has the molecular formula C20H26O2Si and a molecular weight of 326.51 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-diphenyl-3-trimethylsilyloxypropan-1-one.
| Compound Name | 2,2-dimethyl-1,3-diphenyl-3-trimethylsilyloxypropan-1-one |
|---|---|
| PubChem CID | 122206427 |
| Molecular Formula | C20H26O2Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2,2-dimethyl-1,3-diphenyl-3-trimethylsilyloxypropan-1-one |
| SMILES | CC(C)(C(=O)c1ccccc1)C(O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H26O2Si/c1-20(2,18(21)16-12-8-6-9-13-16)19(22-23(3,4)5)17-14-10-7-11-15-17/h6-15,19H,1-5H3 |
| InChIKey | XLLJMTQMHRLCAS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|