C15H23BrO3Si — CID 134930806
methyl 3-(4-bromophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate (PubChem CID 134930806) has the molecular formula C15H23BrO3Si and a molecular weight of 359.34 g/mol. Its IUPAC name is methyl 3-(4-bromophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate.
| Compound Name | methyl 3-(4-bromophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate |
|---|---|
| PubChem CID | 134930806 |
| Molecular Formula | C15H23BrO3Si |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | methyl 3-(4-bromophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate |
| SMILES | COC(=O)C(C)(C)C(O[Si](C)(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H23BrO3Si/c1-15(2,14(17)18-3)13(19-20(4,5)6)11-7-9-12(16)10-8-11/h7-10,13H,1-6H3 |
| InChIKey | DCQXQTLFMPNDAX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|