C14H18BrNO3 — CID 126577006
methyl 4-amino-2-[(1R)-1-(4-bromophenyl)ethyl]-2-methyl-4-oxobutanoate (PubChem CID 126577006) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is methyl 4-amino-2-[(1R)-1-(4-bromophenyl)ethyl]-2-methyl-4-oxobutanoate.
| Compound Name | methyl 4-amino-2-[(1R)-1-(4-bromophenyl)ethyl]-2-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 126577006 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | methyl 4-amino-2-[(1R)-1-(4-bromophenyl)ethyl]-2-methyl-4-oxobutanoate |
| SMILES | COC(=O)C(C)(CC(N)=O)[C@H](C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H18BrNO3/c1-9(10-4-6-11(15)7-5-10)14(2,8-12(16)17)13(18)19-3/h4-7,9H,8H2,1-3H3,(H2,16,17)/t9-,14?/m1/s1 |
| InChIKey | MEXCZQSPIWOLAM-UCWRFOARSA-N |
| XLogP | 2.61 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |