C10H21NO3 — CID 16658549
methyl 3-(hydroxyamino)-2,2,4,4-tetramethylpentanoate (PubChem CID 16658549) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is methyl 3-(hydroxyamino)-2,2,4,4-tetramethylpentanoate.
| Compound Name | methyl 3-(hydroxyamino)-2,2,4,4-tetramethylpentanoate |
|---|---|
| PubChem CID | 16658549 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | methyl 3-(hydroxyamino)-2,2,4,4-tetramethylpentanoate |
| SMILES | COC(=O)C(C)(C)C(NO)C(C)(C)C |
| InChI | InChI=1S/C10H21NO3/c1-9(2,3)7(11-13)10(4,5)8(12)14-6/h7,11,13H,1-6H3 |
| InChIKey | CNBDDWQVKDYHDD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|