About methyl 3-(dimethylamino)-2,2,4,4-tetramethylpentanoate
methyl 3-(dimethylamino)-2,2,4,4-tetramethylpentanoate (PubChem CID 116910331) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is methyl 3-(dimethylamino)-2,2,4,4-tetramethylpentanoate.
Analyze methyl 3-(dimethylamino)-2,2,4,4-tetramethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(dimethylamino)-2,2,4,4-tetramethylpentanoate?
The IUPAC name of methyl 3-(dimethylamino)-2,2,4,4-tetramethylpentanoate (CID 116910331) is methyl 3-(dimethylamino)-2,2,4,4-tetramethylpentanoate.
What is the SMILES notation for methyl 3-(dimethylamino)-2,2,4,4-tetramethylpentanoate?
The canonical SMILES for methyl 3-(dimethylamino)-2,2,4,4-tetramethylpentanoate is COC(=O)C(C)(C)C(N(C)C)C(C)(C)C.
What is the InChIKey of methyl 3-(dimethylamino)-2,2,4,4-tetramethylpentanoate?
The InChIKey is MDIUUMVEBFOKRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-11(2,3)9(13(6)7)12(4,5)10(14)15-8/h9H,1-8H3.
What are the key properties of methyl 3-(dimethylamino)-2,2,4,4-tetramethylpentanoate?
methyl 3-(dimethylamino)-2,2,4,4-tetramethylpentanoate has a molecular weight of 215.34 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(dimethylamino)-2,2,4,4-tetramethylpentanoate is sourced from PubChem (CID 116910331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).