C11H21NO4 — CID 105489493
dimethyl 3-amino-2,2,4,4-tetramethylpentanedioate (PubChem CID 105489493) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is dimethyl 3-amino-2,2,4,4-tetramethylpentanedioate.
| Compound Name | dimethyl 3-amino-2,2,4,4-tetramethylpentanedioate |
|---|---|
| PubChem CID | 105489493 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | dimethyl 3-amino-2,2,4,4-tetramethylpentanedioate |
| SMILES | COC(=O)C(C)(C)C(N)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C11H21NO4/c1-10(2,8(13)15-5)7(12)11(3,4)9(14)16-6/h7H,12H2,1-6H3 |
| InChIKey | QHWBVRCAYAXIOA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |