C12H18O7 — CID 139054712
3-O-(3-methoxy-2,2-dimethyl-3-oxopropanoyl) 1-O-methyl 2,2-dimethylpropanedioate (PubChem CID 139054712) has the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol. Its IUPAC name is 3-O-(3-methoxy-2,2-dimethyl-3-oxopropanoyl) 1-O-methyl 2,2-dimethylpropanedioate.
| Compound Name | 3-O-(3-methoxy-2,2-dimethyl-3-oxopropanoyl) 1-O-methyl 2,2-dimethylpropanedioate |
|---|---|
| PubChem CID | 139054712 |
| Molecular Formula | C12H18O7 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-O-(3-methoxy-2,2-dimethyl-3-oxopropanoyl) 1-O-methyl 2,2-dimethylpropanedioate |
| SMILES | COC(=O)C(C)(C)C(=O)OC(=O)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C12H18O7/c1-11(2,7(13)17-5)9(15)19-10(16)12(3,4)8(14)18-6/h1-6H3 |
| InChIKey | KGESWRZHHOFULR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|