C6H13ClN2O2 — CID 170558694
methyl 3-amino-3-imino-2,2-dimethylpropanoate;hydrochloride (PubChem CID 170558694) has the molecular formula C6H13ClN2O2 and a molecular weight of 180.64 g/mol. Its IUPAC name is methyl 3-amino-3-imino-2,2-dimethylpropanoate;hydrochloride.
| Compound Name | methyl 3-amino-3-imino-2,2-dimethylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 170558694 |
| Molecular Formula | C6H13ClN2O2 |
| Molecular Weight | 180.64 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | methyl 3-amino-3-imino-2,2-dimethylpropanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C6H12N2O2.ClH/c1-6(2,4(7)8)5(9)10-3;/h1-3H3,(H3,7,8);1H |
| InChIKey | QBRRZCGDPCMWGA-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.64 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|