C5H14Cl2N4 — CID 140977550
2,2-dimethylpropanediimidamide;dihydrochloride (PubChem CID 140977550) has the molecular formula C5H14Cl2N4 and a molecular weight of 201.10 g/mol. Its IUPAC name is 2,2-dimethylpropanediimidamide;dihydrochloride.
| Compound Name | 2,2-dimethylpropanediimidamide;dihydrochloride |
|---|---|
| PubChem CID | 140977550 |
| Molecular Formula | C5H14Cl2N4 |
| Molecular Weight | 201.10 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2,2-dimethylpropanediimidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)C(C)(C)/C(N)=N/[H] |
| InChI | InChI=1S/C5H12N4.2ClH/c1-5(2,3(6)7)4(8)9;;/h1-2H3,(H3,6,7)(H3,8,9);2*1H |
| InChIKey | AVTOJWAAXIRJMK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.10 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|