C3H6Cl2N4 — CID 4114057
2,2-dichloropropanediimidamide (PubChem CID 4114057) has the molecular formula C3H6Cl2N4 and a molecular weight of 169.02 g/mol. Its IUPAC name is 2,2-dichloropropanediimidamide.
| Compound Name | 2,2-dichloropropanediimidamide |
|---|---|
| PubChem CID | 4114057 |
| Molecular Formula | C3H6Cl2N4 |
| Molecular Weight | 169.02 g/mol |
| Exact Mass | 168.00 |
| IUPAC Name | 2,2-dichloropropanediimidamide |
| SMILES | [H]/N=C(\N)C(Cl)(Cl)/C(N)=N/[H] |
| InChI | InChI=1S/C3H6Cl2N4/c4-3(5,1(6)7)2(8)9/h(H3,6,7)(H3,8,9) |
| InChIKey | RHWHKXVVUOBOCO-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.02 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|