C10H22N2 — CID 123171886
2,2,4,4-tetramethylhexanimidamide (PubChem CID 123171886) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 2,2,4,4-tetramethylhexanimidamide.
| Compound Name | 2,2,4,4-tetramethylhexanimidamide |
|---|---|
| PubChem CID | 123171886 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 2,2,4,4-tetramethylhexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CC(C)(C)CC |
| InChI | InChI=1S/C10H22N2/c1-6-9(2,3)7-10(4,5)8(11)12/h6-7H2,1-5H3,(H3,11,12) |
| InChIKey | WPTAYGXCORZCQL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|