C10H23N3 — CID 65250610
2,2-dimethyl-4-[methyl(propyl)amino]butanimidamide (PubChem CID 65250610) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is 2,2-dimethyl-4-[methyl(propyl)amino]butanimidamide.
| Compound Name | 2,2-dimethyl-4-[methyl(propyl)amino]butanimidamide |
|---|---|
| PubChem CID | 65250610 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | 2,2-dimethyl-4-[methyl(propyl)amino]butanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCN(C)CCC |
| InChI | InChI=1S/C10H23N3/c1-5-7-13(4)8-6-10(2,3)9(11)12/h5-8H2,1-4H3,(H3,11,12) |
| InChIKey | FCMFHYXMOBMVPJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|