C16H27N3 — CID 65252661
4-(N-butylanilino)-2,2-dimethylbutanimidamide (PubChem CID 65252661) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is 4-(N-butylanilino)-2,2-dimethylbutanimidamide.
| Compound Name | 4-(N-butylanilino)-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 65252661 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 4-(N-butylanilino)-2,2-dimethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCN(CCCC)c1ccccc1 |
| InChI | InChI=1S/C16H27N3/c1-4-5-12-19(14-9-7-6-8-10-14)13-11-16(2,3)15(17)18/h6-10H,4-5,11-13H2,1-3H3,(H3,17,18) |
| InChIKey | TXQUFDJTSNJNQK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|