C17H29N3 — CID 65258340
5-(N-butylanilino)-2,2-dimethylpentanimidamide (PubChem CID 65258340) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is 5-(N-butylanilino)-2,2-dimethylpentanimidamide.
| Compound Name | 5-(N-butylanilino)-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 65258340 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | 5-(N-butylanilino)-2,2-dimethylpentanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCN(CCCC)c1ccccc1 |
| InChI | InChI=1S/C17H29N3/c1-4-5-13-20(15-10-7-6-8-11-15)14-9-12-17(2,3)16(18)19/h6-8,10-11H,4-5,9,12-14H2,1-3H3,(H3,18,19) |
| InChIKey | IRMBETBHYPAQSU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|