C15H25N3 — CID 65258136
5-(N,4-dimethylanilino)-2,2-dimethylpentanimidamide (PubChem CID 65258136) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is 5-(N,4-dimethylanilino)-2,2-dimethylpentanimidamide.
| Compound Name | 5-(N,4-dimethylanilino)-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 65258136 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 5-(N,4-dimethylanilino)-2,2-dimethylpentanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCN(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H25N3/c1-12-6-8-13(9-7-12)18(4)11-5-10-15(2,3)14(16)17/h6-9H,5,10-11H2,1-4H3,(H3,16,17) |
| InChIKey | TWGXENSEBUSGKH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|