C14H25N — CID 176937760
N-butyl-N,4-dimethylaniline;ethane (PubChem CID 176937760) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is N-butyl-N,4-dimethylaniline;ethane.
| Compound Name | N-butyl-N,4-dimethylaniline;ethane |
|---|---|
| PubChem CID | 176937760 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | N-butyl-N,4-dimethylaniline;ethane |
| SMILES | CC.CCCCN(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H19N.C2H6/c1-4-5-10-13(3)12-8-6-11(2)7-9-12;1-2/h6-9H,4-5,10H2,1-3H3;1-2H3 |
| InChIKey | YACHVAPPDKPWIC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|