About ethane;4-methyl-N,N-dipentylaniline
ethane;4-methyl-N,N-dipentylaniline (PubChem CID 144729542) has the molecular formula C21H41N
and a molecular weight of 307.57 g/mol. Its IUPAC name is ethane;4-methyl-N,N-dipentylaniline.
Molecular Properties
| Compound Name | ethane;4-methyl-N,N-dipentylaniline |
| PubChem CID | 144729542 |
| Molecular Formula | C21H41N |
| Molecular Weight | 307.57 g/mol |
| Exact Mass | 307.32 |
| IUPAC Name | ethane;4-methyl-N,N-dipentylaniline |
| SMILES | CC.CC.CCCCCN(CCCCC)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H29N.2C2H6/c1-4-6-8-14-18(15-9-7-5-2)17-12-10-16(3)11-13-17;2*1-2/h10-13H,4-9,14-15H2,1-3H3;2*1-2H3 |
| InChIKey | RZHHHSVUMDQCKM-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.57 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-methyl-N,N-dipentylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-N,N-dipentylaniline?
The IUPAC name of ethane;4-methyl-N,N-dipentylaniline (CID 144729542) is ethane;4-methyl-N,N-dipentylaniline.
What is the SMILES notation for ethane;4-methyl-N,N-dipentylaniline?
The canonical SMILES for ethane;4-methyl-N,N-dipentylaniline is CC.CC.CCCCCN(CCCCC)c1ccc(C)cc1.
What is the InChIKey of ethane;4-methyl-N,N-dipentylaniline?
The InChIKey is RZHHHSVUMDQCKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N.2C2H6/c1-4-6-8-14-18(15-9-7-5-2)17-12-10-16(3)11-13-17;2*1-2/h10-13H,4-9,14-15H2,1-3H3;2*1-2H3.
What are the key properties of ethane;4-methyl-N,N-dipentylaniline?
ethane;4-methyl-N,N-dipentylaniline has a molecular weight of 307.57 g/mol, XLogP of 7.23, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-N,N-dipentylaniline is sourced from PubChem (CID 144729542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).