C21H37N — CID 20558578
N,N-diheptyl-4-methylaniline (PubChem CID 20558578) has the molecular formula C21H37N and a molecular weight of 303.53 g/mol. Its IUPAC name is N,N-diheptyl-4-methylaniline.
| Compound Name | N,N-diheptyl-4-methylaniline |
|---|---|
| PubChem CID | 20558578 |
| Molecular Formula | C21H37N |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | N,N-diheptyl-4-methylaniline |
| SMILES | CCCCCCCN(CCCCCCC)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H37N/c1-4-6-8-10-12-18-22(19-13-11-9-7-5-2)21-16-14-20(3)15-17-21/h14-17H,4-13,18-19H2,1-3H3 |
| InChIKey | GDLQHGLLUIWQAD-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|